CAS 1072-10-2
:5-(Acetylamino)pentanoic acid
Description:
5-(Acetylamino)pentanoic acid, with the CAS number 1072-10-2, is an organic compound characterized by its structure, which includes a pentanoic acid backbone with an acetylamino group at the fifth carbon position. This compound is classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid group, which are typical functional groups in amino acids. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to its polar functional groups. The presence of the acetylamino group enhances its reactivity and potential applications in biochemical processes, such as peptide synthesis or as a building block in pharmaceuticals. Additionally, it may exhibit properties such as being a zwitterion at physiological pH, which can influence its behavior in biological systems. Overall, 5-(Acetylamino)pentanoic acid is of interest in both synthetic organic chemistry and biochemistry.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-6(9)8-5-3-2-4-7(10)11/h2-5H2,1H3,(H,8,9)(H,10,11)
InChI key:InChIKey=TZZSWAXSIGWXOS-UHFFFAOYSA-N
SMILES:C(CC(O)=O)CCNC(C)=O
Synonyms:- 5-(Acetylamino)pentanoic acid
- Pentanoic acid, 5-(acetylamino)-
- 5-Acetamidovaleric acid
- Valeric acid, 5-acetamido-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
