CAS 1072-40-8
:2,5,8,11,14,17,20-Heptaoxaheneicosane
Description:
2,5,8,11,14,17,20-Heptaoxaheneicosane, with the CAS number 1072-40-8, is a synthetic organic compound characterized by its long carbon chain and multiple ether functional groups. Specifically, it consists of a linear chain of 21 carbon atoms, interspersed with seven oxygen atoms in the form of ether linkages. This structure contributes to its unique physical and chemical properties, such as increased solubility in polar solvents compared to typical hydrocarbons. The presence of multiple ether groups can also enhance its thermal stability and influence its reactivity, making it of interest in various applications, including materials science and organic synthesis. Additionally, the compound's molecular structure may impart specific biological activities, although detailed studies on its biological effects may be limited. Overall, 2,5,8,11,14,17,20-Heptaoxaheneicosane exemplifies the complexity and versatility of synthetic organic compounds, particularly those featuring multiple functional groups.
Formula:C14H30O7
InChI:InChI=1S/C14H30O7/c1-15-3-5-17-7-9-19-11-13-21-14-12-20-10-8-18-6-4-16-2/h3-14H2,1-2H3
InChI key:InChIKey=VMCIKMLQXFLKAX-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOC)CCOCCOCCOC
Synonyms:- 2,5,8,11,14,17,20-Heptaoxaheneicosane
- Glyme 7
- Hexaethylene glycol, dimethyl ether
- Hexaglyme
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5,8,11,14,17,20-Heptaoxaheneicosane
CAS:Formula:C14H30O7Purity:98%Color and Shape:LiquidMolecular weight:310.38382,5,8,11,14,17,20-Heptaoxaheneicosane
CAS:2,5,8,11,14,17,20-HeptaoxaheneicosanePurity:98%Molecular weight:310.38g/molHexaethylene glycol dimethyl ether
CAS:Hexaethylene glycol dimethyl ether, a PEG-based PROTAC linker, facilitates the synthesis of PROTACs.Formula:C14H30O7Color and Shape:SolidMolecular weight:310.387Hexaethylene Glycol Dimethyl Ether
CAS:Controlled ProductFormula:C14H30O7Color and Shape:NeatMolecular weight:310.38Hexaethylene glycol dimethyl ether
CAS:Hexaethylene glycol dimethyl ether is a bioinorganic reagent that is used as a solvent in organic chemistry. It is capable of forming stable complexes with metal ions and organic molecules. Hexaethylene glycol dimethyl ether has been shown to form stable complexes with polyethylene glycols, which are used as coatings for products such as food packaging and medical devices. The hydroxyl group on the molecule allows it to react with metal ions, which leads to a change in its coordination geometry. Hexaethylene glycol dimethyl ether can also be used as a reactant in chemical reactions due to its high energy efficiency and low reaction products.Formula:C14H30O7Purity:Min. 95%Color and Shape:Colorless PowderMolecular weight:310.38 g/mol




