CAS 1072-54-4: Cyclotetramethylenedimethylsilane

Description:Cyclotetramethylenedimethylsilane, with the CAS number 1072-54-4, is a cyclic siloxane compound characterized by its unique structure, which consists of a ring of four silicon atoms, each bonded to two methyl groups. This compound exhibits properties typical of silanes, including low volatility and high thermal stability. It is generally colorless and has a low viscosity, making it useful in various applications, particularly in the field of materials science and as a precursor in the synthesis of silicone polymers. The presence of multiple silicon atoms in a cyclic arrangement contributes to its distinctive chemical reactivity, allowing for potential cross-linking and polymerization reactions. Additionally, cyclotetramethylenedimethylsilane is known for its hydrophobic properties, which can enhance the water resistance of materials when incorporated into formulations. Safety data indicates that, like many silanes, it should be handled with care to avoid inhalation or skin contact, as it may cause irritation. Overall, its unique structure and properties make it a valuable compound in both industrial and research applications.

Formula:C₆H₁₄Si

InChI:InChI=1/C6H14Si/c1-7(2)5-3-4-6-7/h3-6H2,1-2H3

Synonyms:
1,1-Dimethyl-1-silacyclopentane
1,1-Dimethylsilolane

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1,1-Dimethyl-1-silacyclopentane REF: IN-DA007T83CAS: 1072-54-4	95%	56.00 €~469.00 €	Mon 10 Mar 25
1,1-Dimethyl-1-silacyclopentane REF: 10-S07435CAS: 1072-54-4	95%	To inquire	Thu 20 Mar 25
Cyclotetramethylenedimethylsilane REF: 3D-BAA07254CAS: 1072-54-4	Min. 95%	- - -	Discontinued product