CAS 1072-70-4

5-Methyl-2-oxazolidinone

Description:

5-Methyl-2-oxazolidinone, also known as 5-methyl-2-oxazolidinone or simply as a derivative of oxazolidinone, is a heterocyclic organic compound characterized by a five-membered ring containing both nitrogen and oxygen atoms. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. This compound is known for its polar nature, which contributes to its solubility in water and various organic solvents. The presence of the methyl group at the 5-position of the oxazolidinone ring influences its reactivity and potential applications in organic synthesis. 5-Methyl-2-oxazolidinone is often utilized as a building block in the synthesis of pharmaceuticals and agrochemicals, owing to its ability to participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₄H₇NO₂

InChI: InChI=1S/C4H7NO2/c1-3-2-5-4(6)7-3/h3H,2H2,1H3,(H,5,6)

InChI key: InChIKey=HBRXQSHUXIJOKV-UHFFFAOYSA-N

SMILES: CC1OC(=O)NC1

Synonyms:

• 2-Oxazolidinone, 5-Methyl-
• 5-Methyl-2-oxazolidinone
• 5-Methyloxazolidone
• NSC 169461
• NSC 37750

5-Methyloxazolidin-2-one

CAS: 1072-70-4

Formula: C₄H₇NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 101.1039

Ref: IN-DA007ATN

5-Methyloxazolidin-2-one

CAS: 1072-70-4

5-Methyloxazolidin-2-one

Purity: 95%

Molecular weight: 101.11g/mol

Ref: 54-OR1052406

5-Methyl-1,3-oxazolidin-2-one

CAS: 1072-70-4

5-Methyl-1,3-oxazolidin-2-one is a synthetic compound that has been studied for its antiproliferative effects. It inhibits the growth of cancer cells by inducing cell cycle arrest and apoptosis. The structural changes in 5-Methyl-1,3-oxazolidin-2-one are responsible for these effects. The asymmetric carbon atom in the molecule allows for stereoisomeric forms to be produced. When this molecule is exposed to metal halides, it undergoes an epoxidation reaction to form an aziridine ring. This ring can then react with hydrotalcite and water to produce hydrogen gas and a carboxylic acid salt.

Formula: C₄H₇NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 101.1 g/mol

Ref: 3D-FM130297

5-methyl-1,3-oxazolidin-2-one

CAS: 1072-70-4

Formula: C₄H₇NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 101.105

Ref: 10-F313072