CAS 107202-68-6

(2E)-4-Tricyclo[3.3.1.13,7]dec-1-yl-2-buten-1-ol

Description:

(2E)-4-Tricyclo[3.3.1.13,7]dec-1-yl-2-buten-1-ol, with the CAS number 107202-68-6, is a complex organic compound characterized by its unique tricyclic structure. This substance features a butenol functional group, which contributes to its reactivity and potential applications in organic synthesis. The tricyclic framework imparts rigidity and specific stereochemical properties, influencing its interactions and stability. Typically, compounds of this nature may exhibit interesting biological activities, making them of interest in medicinal chemistry and natural product synthesis. The presence of the butenol moiety suggests potential for further functionalization, allowing for the development of derivatives with varied properties. Additionally, the compound's stereochemistry can significantly affect its physical properties, such as solubility and boiling point, as well as its biological activity. Overall, (2E)-4-Tricyclo[3.3.1.13,7]dec-1-yl-2-buten-1-ol represents a fascinating subject for study in both theoretical and applied chemistry contexts.

Formula: C₁₄H₂₂O

InChI: InChI=1/C14H22O/c15-4-2-1-3-14-8-11-5-12(9-14)7-13(6-11)10-14/h1-2,11-13,15H,3-10H2/b2-1+

InChI key: InChIKey=XQYORNQHQADBIR-OWOJBTEDNA-N

SMILES: C(/C=C/CO)C12CC3(CC(C1)(CC(C2)(C3)[H])[H])[H]

Synonyms:

• 2-Buten-1-ol, 4-tricyclo[3.3.1.13,7]dec-1-yl-, (2E)-
• 2-Buten-1-ol, 4-tricyclo[3.3.1.13,7]dec-1-yl-, (E)-
• (2E)-4-Tricyclo[3.3.1.13,7]dec-1-yl-2-buten-1-ol