CAS 1072103-29-7

5-(4-Morpholinyl)-2-pyridinecarboxylic acid

Description:

5-(4-Morpholinyl)-2-pyridinecarboxylic acid is a chemical compound characterized by its pyridine and morpholine functional groups. It features a pyridine ring substituted at the 2-position with a carboxylic acid group and at the 5-position with a morpholine moiety. This structure contributes to its potential as a bioactive molecule, often explored in medicinal chemistry for its pharmacological properties. The presence of the morpholine ring enhances solubility and may influence the compound's interaction with biological targets. The carboxylic acid group can participate in hydrogen bonding and ionic interactions, which are crucial for binding affinity in biological systems. This compound is typically a white to off-white solid and is soluble in polar solvents. Its applications may include roles in drug development, particularly in targeting specific receptors or enzymes. As with many chemical substances, safety and handling precautions should be observed, as the biological activity and toxicity profiles can vary significantly based on structural modifications and the specific context of use.

Formula: C₁₀H₁₂N₂O₃

InChI: InChI=1S/C10H12N2O3/c13-10(14)9-2-1-8(7-11-9)12-3-5-15-6-4-12/h1-2,7H,3-6H2,(H,13,14)

InChI key: InChIKey=JMXNPUFRQXPBAT-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=CC(=CN1)N2CCOCC2

Synonyms:

• 5-(4-Morpholinyl)-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-(4-morpholinyl)-
• 5-Morpholinopicolinic acid

5-Morpholinopicolinic acid

CAS: 1072103-29-7

Formula: C₁₀H₁₂N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.2139

Ref: IN-DA009988

5-Morpholinopicolinic acid

CAS: 1072103-29-7

5-Morpholinopicolinic acid

Purity: 98%

Molecular weight: 208.21g/mol

Ref: 54-OR81156

5-Morpholinopicolinic acid

CAS: 1072103-29-7

Formula: C₁₀H₁₂N₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.217

Ref: 10-F327163