CAS 107220-26-8
:1-Azabicyclo[2.2.2]octan-3-ol, 3-(mercaptomethyl)-
Description:
1-Azabicyclo[2.2.2]octan-3-ol, 3-(mercaptomethyl)-, also known by its CAS number 107220-26-8, is a bicyclic compound featuring a nitrogen atom within a bicyclic structure. This compound is characterized by the presence of a hydroxyl group (-OH) and a mercaptomethyl group (-CH2SH) attached to the bicyclic framework. The bicyclic structure contributes to its rigidity and unique spatial arrangement, which can influence its reactivity and interaction with biological systems. The mercaptomethyl group introduces thiol characteristics, making the compound potentially reactive with electrophiles and capable of forming disulfide bonds. Additionally, the hydroxyl group can participate in hydrogen bonding, enhancing solubility in polar solvents. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry and drug design. Overall, its unique combination of functional groups and bicyclic structure provides a foundation for diverse chemical behavior and potential applications in various fields.
Formula:C8H15NOS
InChI:InChI=1/C8H15NOS/c10-8(6-11)5-9-3-1-7(8)2-4-9/h7,10-11H,1-6H2
SMILES:C1CN2CCC1C(C2)(CS)O
Synonyms:- 3-(Sulfanylmethyl)-1-azabicyclo[2.2.2]octan-3-ol
- 3-(Sulfanylmethyl)Quinuclidin-3-Ol
- 3-(Mercaptomethyl)Quinuclidin-3-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Cevimeline Impurity 6
CAS:Formula:C8H15NOSColor and Shape:White To Off-White SolidMolecular weight:173.27rac 3-Hydroxy-3-mercaptomethylquinuclidine
CAS:Controlled ProductApplications Intermediate in the preparation of Cevimeline and respective derivatives.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C8H15NOSColor and Shape:NeatMolecular weight:173.28


