CAS 107220-29-1

(2'R)-2'-methylspiro[4-azabicyclo[2.2.2]octane-2,5'-[1,3]oxathiolane] hydrochloride

Description:

(2'R)-2'-methylspiro[4-azabicyclo[2.2.2]octane-2,5'-[1,3]oxathiolane] hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a bicyclic amine and an oxathiolane moiety. This compound features a chiral center, indicated by the (2'R) designation, which contributes to its potential biological activity and specificity in interactions with biological targets. The presence of the hydrochloride salt form enhances its solubility in aqueous environments, making it suitable for various pharmaceutical applications. The bicyclic framework is known for its rigidity, which can influence the compound's pharmacokinetic properties, such as absorption and metabolism. Additionally, the oxathiolane ring may impart specific reactivity or binding characteristics, potentially making this compound of interest in medicinal chemistry, particularly in the development of novel therapeutics. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of potential applications in drug discovery and development.

Formula: C₁₀H₁₈ClNOS

InChI: InChI=1/C10H17NOS.ClH/c1-8-12-10(7-13-8)6-11-4-2-9(10)3-5-11;/h8-9H,2-7H2,1H3;1H/t8-,10?;/m1./s1

SMILES: C[C@@H]1OC2(CN3CCC2CC3)CS1.Cl

trans-Cevimeline hydrochloride

CAS: 107220-29-1

AF 102A hydrochloride is a biochemical.

Formula: C₁₀H₁₈ClNOS

Color and Shape: Solid

Molecular weight: 235.77

Ref: TM-T29681

trans-Cevimeline HCl

CAS: 107220-29-1

Formula: C₁₀H₁₇NOS·HCl

Molecular weight: 199.31 36.46

Ref: 4Z-C-209008

rac,trans-Cevimeline Hydrochloride

Controlled Product

CAS: 107220-29-1

Stability Hygroscopic
Applications trans-Cevimeline Hydrochloride is a reagent in the preparation of spiro-oxathiolane/quinuclidine sulfoxide derivative for the treatment of central nervous and cholinergic system disease or disorders.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Fisher, A., et al.: Eur. Pat. Appl., 1990:48812 (1990)

Formula: C₁₀H₁₈ClNOS

Color and Shape: Neat

Molecular weight: 235.77

Ref: TR-C283525

Trans-Cevimeline Hydrochloride

CAS: 107220-29-1

Formula: C₁₀H₁₇NOSHCl

Molecular weight: 199.3 : 36.5

Ref: ST-EA-CP-C62005