CAS 107220-29-1
:(2'R)-2'-methylspiro[4-azabicyclo[2.2.2]octane-2,5'-[1,3]oxathiolane] hydrochloride
Description:
(2'R)-2'-methylspiro[4-azabicyclo[2.2.2]octane-2,5'-[1,3]oxathiolane] hydrochloride is a chemical compound characterized by its unique spirocyclic structure, which incorporates both a bicyclic amine and an oxathiolane moiety. This compound features a chiral center, indicated by the (2'R) designation, which contributes to its potential biological activity and specificity in interactions with biological targets. The presence of the hydrochloride salt form enhances its solubility in aqueous environments, making it suitable for various pharmaceutical applications. The bicyclic framework is known for its rigidity, which can influence the compound's pharmacokinetic properties, such as absorption and metabolism. Additionally, the oxathiolane ring may impart specific reactivity or binding characteristics, potentially making this compound of interest in medicinal chemistry, particularly in the development of novel therapeutics. Overall, the structural complexity and functional groups present in this compound suggest a diverse range of potential applications in drug discovery and development.
Formula:C10H18ClNOS
InChI:InChI=1/C10H17NOS.ClH/c1-8-12-10(7-13-8)6-11-4-2-9(10)3-5-11;/h8-9H,2-7H2,1H3;1H/t8-,10?;/m1./s1
SMILES:C[C@@H]1OC2(CN3CCC2CC3)CS1.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
trans-Cevimeline hydrochloride
CAS:AF 102A hydrochloride is a biochemical.Formula:C10H18ClNOSColor and Shape:SolidMolecular weight:235.77rac,trans-Cevimeline Hydrochloride
CAS:Controlled ProductStability Hygroscopic
Applications trans-Cevimeline Hydrochloride is a reagent in the preparation of spiro-oxathiolane/quinuclidine sulfoxide derivative for the treatment of central nervous and cholinergic system disease or disorders.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Fisher, A., et al.: Eur. Pat. Appl., 1990:48812 (1990)Formula:C10H18ClNOSColor and Shape:NeatMolecular weight:235.77



