
CAS 107221-01-2
:Tetracosanamide, N-[1-[[[O-2-(acetylamino)-2-deoxy-β-D-galactopyranosyl-(1→4)-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)]-O-β-D-galactopyranosyl-(1→4)-β-D-glucopyranosyl]oxy]methyl]-2-hydroxy-3-heptadecenyl]-, [R-[R*,S*-(E)]]-
Description:
Tetracosanamide, with the CAS number 107221-01-2, is a complex chemical compound characterized by its long-chain fatty acid amide structure. It features a tetracosane backbone, which consists of 24 carbon atoms, contributing to its hydrophobic properties. The molecule also contains multiple sugar moieties, specifically galactose and glucose derivatives, which are linked through glycosidic bonds, imparting hydrophilic characteristics. The presence of acetylamino groups enhances its solubility in polar solvents and may influence its biological activity. The specific stereochemistry indicated by the R and S designations suggests that the compound has chiral centers, which can affect its interaction with biological systems. Additionally, the presence of a double bond in the heptadecenyl chain introduces unsaturation, which can influence the compound's reactivity and physical properties. Overall, tetracosanamide is likely to exhibit amphiphilic behavior, making it relevant in various applications, including drug delivery systems and as a surfactant in biochemical contexts.
Formula:C70H129N3O23
InChI:InChI=1S/C70H129N3O23/c1-5-7-9-11-13-15-17-19-20-21-22-23-24-25-26-28-30-32-34-36-38-40-54(81)73-48(49(80)39-37-35-33-31-29-27-18-16-14-12-10-8-6-2)45-89-69-62(87)61(86)64(52(43-76)92-69)94-70-63(88)66(96-68-56(72-47(4)79)60(85)58(83)51(42-75)91-68)65(53(44-77)93-70)95-67-55(71-46(3)78)59(84)57(82)50(41-74)90-67/h37,39,48-53,55-70,74-77,80,82-88H,5-36,38,40-45H2,1-4H3,(H,71,78)(H,72,79)(H,73,81)
InChI key:InChIKey=YAVBLHXWKRSXJS-UHFFFAOYSA-N
SMILES:O(C1C(OC2C(NC(C)=O)C(O)C(O)C(CO)O2)C(O)C(OC3C(CO)OC(OCC(NC(CCCCCCCCCCCCCCCCCCCCCCC)=O)C(C=CCCCCCCCCCCCCC)O)C(O)C3O)OC1CO)C4C(NC(C)=O)C(O)C(O)C(CO)O4
Synonyms:- Glycolipid M1-XGL-1
- Tetracosanamide, N-[1-[[[O-2-(acetylamino)-2-deoxy-β-D-galactopyranosyl-(1→4)-O-[2-(acetylamino)-2-deoxy-β-D-glucopyranosyl-(1→3)]-O-β-D-galactopyranosyl-(1→4)-β-D-glucopyranosyl]oxy]methyl]-2-hydroxy-3-heptadecenyl]-, [R-[R*,S*-(E)]]-
- M1-XGL-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lactogangliotetraosylceramide
CAS:Lactogangliotetraosylceramide is a leukemia-associated antigen possessing a novel branching structure.Formula:C70H129N3O23Color and Shape:SolidMolecular weight:1380.8
