CAS 107240-29-9
:monofluoromethylagmatine
Description:
Monofluoromethylagmatine is a chemical compound characterized by the presence of a fluoromethyl group attached to the agmatine structure. Agmatine itself is a biogenic amine derived from the amino acid arginine and is known for its role in various biological processes, including neurotransmission and cellular signaling. The introduction of a fluoromethyl group can influence the compound's pharmacological properties, potentially enhancing its bioactivity or altering its interaction with biological targets. Monofluoromethylagmatine may exhibit unique solubility, stability, and reactivity profiles compared to its non-fluorinated counterparts. Its specific applications and effects in biological systems are subjects of ongoing research, particularly in the context of neuropharmacology and potential therapeutic uses. As with many fluorinated compounds, the presence of fluorine can also affect the compound's metabolic pathways and bioavailability. Overall, monofluoromethylagmatine represents an interesting area of study within medicinal chemistry and pharmacology.
Formula:C6H15FN4
InChI:InChI=1/C6H15FN4/c7-4-5(8)2-1-3-11-6(9)10/h5H,1-4,8H2,(H4,9,10,11)
SMILES:C(CC(CF)N)CNC(=N)N
Synonyms:- Fluoromethylagmatine
- Guanidine, (4-amino-5-fluoropentyl)-
- 2-(4-Amino-5-Fluoropentyl)Guanidine
- Monofluoromethylagmatine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Monofluoromethylagmatine
CAS:Monofluoromethylagmatine is an arginine decarboxylase inhibitor.Formula:C6H15FN4Color and Shape:SolidMolecular weight:162.21
