CAS 1072433-60-3

1-Methyl-1H-indazole-5-thiol

Description:

1-Methyl-1H-indazole-5-thiol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a thiol (-SH) group at the 5-position of the indazole ring imparts unique reactivity and properties, including the ability to form disulfide bonds and participate in redox reactions. The methyl group at the 1-position enhances the lipophilicity of the molecule, potentially influencing its biological activity and solubility. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, which could be explored in the context of therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. As with many thiol-containing compounds, it may also be sensitive to oxidation, which can affect its chemical behavior and applications in research or industry.

Formula: C₈H₈N₂S

InChI: InChI=1S/C8H8N2S/c1-10-8-3-2-7(11)4-6(8)5-9-10/h2-5,11H,1H3

InChI key: InChIKey=XWBFBVNWYSDXRA-UHFFFAOYSA-N

SMILES: CN1C=2C(C=N1)=CC(S)=CC2

Synonyms:

• 1H-Indazole-5-thiol, 1-methyl-
• 1-Methyl-1H-indazole-5-thiol