CAS 107244-34-8
:1,6,7,8-Indolizinetetrol, octahydro-, (1S,6R,7R,8R,8aR)-
Description:
1,6,7,8-Indolizinetetrol, octahydro-, (1S,6R,7R,8R,8aR)-, with CAS number 107244-34-8, is a bicyclic organic compound characterized by its indolizine structure, which features a fused ring system. This compound is a type of polyol, containing multiple hydroxyl (-OH) groups that contribute to its hydrophilicity and potential reactivity. The stereochemistry indicated by the (1S,6R,7R,8R,8aR) designation suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple hydroxyl groups can also enhance solubility in polar solvents and may facilitate hydrogen bonding. Overall, the unique structural and stereochemical features of 1,6,7,8-Indolizinetetrol position it as a compound of potential interest in various chemical and biological applications.
Formula:C8H15NO4
InChI:InChI=1/C8H15NO4/c10-4-1-2-9-3-5(11)7(12)8(13)6(4)9/h4-8,10-13H,1-3H2/t4-,5+,6+,7+,8+/m0/s1
Synonyms:- (1S,6R,7R,8R,8aR)-Octahydroindolizine-1,6,7,8-tetrol
- 1,6,7,8-indolizinetetrol, octahydro-, (1S,6R,7R,8R,8aR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Epi-castanospermine
CAS:6-Epi-castanospermine is a nitro compound that is synthesized by the allylic oxidation of castanospermine. It has been shown to inhibit glycosidases and glycosidase inhibitors in vitro, including those from the families of α-amylase, α-L-arabinofuranosidases, β-hexosaminidases, α-glucuronidases, and phytases. 6-Epi-castanospermine has also been used as an intermediate for the synthesis of chiral polyhydroxylated compounds. The 13C NMR spectrum of this compound was found to be diagnostic for its structural assignment.
Formula:C8H15NO4Purity:Min. 95 Area-%Color and Shape:White Off-White PowderMolecular weight:189.21 g/mol
