CAS 1072449-67-2

α-Chloro-3-fluorobenzeneacetic acid

Description:

α-Chloro-3-fluorobenzeneacetic acid, identified by its CAS number 1072449-67-2, is an organic compound characterized by the presence of both chlorine and fluorine substituents on a benzene ring, along with a carboxylic acid functional group. This compound typically exhibits a polar nature due to the carboxylic acid group, which can participate in hydrogen bonding, influencing its solubility in polar solvents. The presence of the chlorine and fluorine atoms introduces unique electronic properties, potentially affecting its reactivity and interaction with biological systems. α-Chloro-3-fluorobenzeneacetic acid may be utilized in various chemical syntheses and could serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. Safety data sheets would provide essential information regarding handling, storage, and potential hazards associated with this compound. Overall, its unique structure and functional groups make it a compound of interest in organic chemistry and related fields.

Formula: C₈H₆ClFO₂

InChI: InChI=1S/C8H6ClFO2/c9-7(8(11)12)5-2-1-3-6(10)4-5/h1-4,7H,(H,11,12)

InChI key: InChIKey=GIQHEKHTEUYFLW-UHFFFAOYSA-N

SMILES: C(C(O)=O)(Cl)C1=CC(F)=CC=C1

Synonyms:

• 2-Chloro-2-(3-fluorophenyl)acetic acid
• Benzeneacetic acid, α-chloro-3-fluoro-
• α-Chloro-3-fluorobenzeneacetic acid