CAS 107257-16-9
:3-O-methyl-6-fluoro-dopa
Description:
3-O-Methyl-6-fluoro-dopa is a chemical compound that belongs to the class of amino acids and is a derivative of the neurotransmitter dopamine. It features a fluorine atom at the 6-position and a methoxy group at the 3-position of the aromatic ring, which influences its biological activity and pharmacological properties. This compound is known for its potential role in the treatment of neurological disorders, particularly in the context of Parkinson's disease, as it may serve as a precursor to dopamine synthesis. The presence of the fluorine atom can enhance the compound's lipophilicity, potentially improving its ability to cross the blood-brain barrier. Additionally, the methoxy group may affect the compound's solubility and stability. As with many derivatives of dopa, 3-O-methyl-6-fluoro-dopa may exhibit varying degrees of activity at dopamine receptors, making it a subject of interest in medicinal chemistry and neuropharmacology. Its specific interactions and effects in biological systems are areas of ongoing research.
Formula:C10H1218FNO4
InChI:InChI=1/C10H12FNO4/c1-16-9-3-5(2-7(12)10(14)15)6(11)4-8(9)13/h3-4,7,13H,2,12H2,1H3,(H,14,15)/t7-/m0/s1/i11-1
SMILES:COc1cc(C[C@@H](C(=O)O)N)c(cc1O)[18F]
Synonyms:- 18F-30M-Dopa
- 3,4-Dihydroxy-6-fluoro-3-O-methylphenylalanine
- 3-MF-Dopa
- 3-O-Methyl-6-(18F)fluoro-L-dopa
- 3-Omfd
- 6-Fluoro-3-O-methyl-L-dopa
- L-Tyrosine, 2-(fluoro-18F)-5-methoxy-
- 2-(~18~F)fluoro-5-methoxy-L-tyrosine
- 3-O-Methyl-6-fluoro-dopa
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.