CAS 107259-48-3
:aristolochic acid E
Description:
Aristolochic acid E is a naturally occurring compound primarily derived from plants in the Aristolochiaceae family. It is known for its structural features, which include a bicyclic structure with a carboxylic acid functional group. This compound exhibits significant biological activity, particularly as a potent nephrotoxin and carcinogen, raising concerns regarding its safety and potential health risks. Aristolochic acid E has been studied for its effects on cellular mechanisms, including its ability to form DNA adducts, which can lead to mutagenesis and contribute to the development of certain cancers. Its use in traditional medicine has been controversial due to these toxicological properties. Additionally, aristolochic acid E is often monitored in herbal products to prevent exposure, as it can be associated with various adverse health outcomes. Regulatory agencies have issued warnings regarding the consumption of products containing this compound, emphasizing the importance of awareness and caution in its use.
Formula:C17H11NO8
InChI:InChI=1/C17H11NO8/c1-24-11-3-2-7-8(15(11)19)4-10(18(22)23)13-9(17(20)21)5-12-16(14(7)13)26-6-25-12/h2-5,19H,6H2,1H3,(H,20,21)
SMILES:COc1ccc2c(cc(c3c(cc4c(c23)OCO4)C(=O)O)N(=O)=O)c1O
Synonyms:- 7-Methoxy-8-hydroxyaristolochic acid
- Phenanthro(3,4-d)-1,3-dioxole-5-carboxylic acid, 8-hydroxy-9-methoxy-6-nitro-
- 8-Hydroxy-9-Methoxy-6-Nitrophenanthro[3,4-D][1,3]Dioxole-5-Carboxylic Acid
- Aristolochic acid E
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
