CAS 107265-48-5
:4-((1,4,8,11-tetraazacyclotetradec-1-yl)methyl)benzoic acid
Description:
4-((1,4,8,11-tetraazacyclotetradec-1-yl)methyl)benzoic acid, identified by its CAS number 107265-48-5, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a tetraazacyclotetradecane ring. This compound features multiple nitrogen atoms within its cyclic structure, contributing to its potential chelating properties, particularly in coordination chemistry. The presence of the benzoic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and salt formation. Its unique structure may also influence its solubility, stability, and reactivity in different solvents. Additionally, the tetraazacyclotetradecane component suggests potential applications in fields such as medicinal chemistry, where it may serve as a ligand in metal ion coordination or as a building block in the synthesis of more complex molecules. Overall, this compound's distinctive features make it of interest in both academic research and potential industrial applications.
Formula:C18H30N4O2
InChI:InChI=1/C18H30N4O2/c23-18(24)17-5-3-16(4-6-17)15-22-13-2-9-20-11-10-19-7-1-8-21-12-14-22/h3-6,19-21H,1-2,7-15H2,(H,23,24)
SMILES:C1CNCCNCCCN(CCNC1)Cc1ccc(cc1)C(=O)O
Synonyms:- Ctpa
- Benzoic acid, 4-(1,4,8,11-tetraazacyclotetradec-1-ylmethyl)-
- 4-(1,4,8,11-Tetraazacyclotetradecan-1-Ylmethyl)Benzoic Acid
- 4-((1,4,8,11-Tetraazacyclotetradec-1-yl)methyl)benzoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
