CAS 107266-08-0
:Carvotroline
Description:
Carvotroline, with the CAS number 107266-08-0, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from natural sources, particularly from certain plant species. Carvotroline is characterized by its unique molecular structure, which includes a bicyclic framework that contributes to its biological activity. This compound has been studied for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Additionally, carvotroline may exhibit interactions with various biological targets, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the conditions, such as pH and temperature, which are important factors to consider in its applications. As with many alkaloids, the safety and toxicity profile of carvotroline should be evaluated in the context of its intended use, particularly in therapeutic settings. Overall, carvotroline represents a fascinating area of study within natural product chemistry and pharmacology.
Formula:C18H18FN3
InChI:InChI=1/C18H18FN3/c19-14-1-2-17-15(11-14)16-12-22(10-6-18(16)21-17)9-5-13-3-7-20-8-4-13/h1-4,7-8,11,21H,5-6,9-10,12H2
SMILES:c1cc2c(cc1F)c1CN(CCc3ccncc3)CCc1[nH]2
Synonyms:- Carvotroline [INN]
- Unii-1Q63Wwp8G5
- 1H-Pyrido(4,3-b)indole, 8-fluoro-2,3,4,5-tetrahydro-2-(2-(4-pyridinyl)ethyl)-
- 8-fluoro-2-[2-(pyridin-4-yl)ethyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole
- Carvotroline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.