CAS 107268-37-1

3-[(2-methylprop-2-en-1-yl)oxy]aniline

Description:

3-[(2-Methylprop-2-en-1-yl)oxy]aniline, with the CAS number 107268-37-1, is an organic compound characterized by the presence of an aniline group substituted with an allyl ether. This compound features a phenolic structure where the hydroxyl group is replaced by an alkoxy group derived from 2-methylprop-2-en-1-ol, contributing to its reactivity and potential applications in organic synthesis. The presence of the allyl group suggests that it may participate in various chemical reactions, such as polymerization or cross-linking, making it valuable in materials science and organic chemistry. Additionally, the compound's structure indicates potential for hydrogen bonding due to the aniline moiety, which may influence its solubility and interaction with other substances. Overall, 3-[(2-methylprop-2-en-1-yl)oxy]aniline is a versatile compound with implications in both industrial and research settings, particularly in the development of new materials and chemical intermediates.

Formula: C₁₀H₁₃NO

InChI: InChI=1/C10H13NO/c1-8(2)7-12-10-5-3-4-9(11)6-10/h3-6H,1,7,11H2,2H3

SMILES: C=C(C)COc1cccc(c1)N

3-[(2-Methylprop-2-en-1-yl)oxy]aniline

CAS: 107268-37-1

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO

Purity: Min. 95%

Molecular weight: 163.22 g/mol

Ref: 3D-HEA26837