CymitQuimica logo

CAS 1072806-65-5

:

2-Benzoxazolemethanamine, hydrochloride (1:1)

Description:
2-Benzoxazolemethanamine, hydrochloride (1:1) is a chemical compound characterized by its benzoxazole ring structure, which contributes to its unique properties. This substance typically appears as a white to off-white crystalline powder and is soluble in water, making it suitable for various applications in pharmaceuticals and research. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility compared to the free base form. The compound may exhibit biological activity, potentially serving as a building block in the synthesis of more complex molecules or as a pharmacological agent. Its molecular structure includes an amine group, which can participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards. Overall, 2-Benzoxazolemethanamine, hydrochloride is of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C8H8N2O·ClH
InChI:InChI=1S/C8H8N2O.ClH/c9-5-8-10-6-3-1-2-4-7(6)11-8;/h1-4H,5,9H2;1H
InChI key:InChIKey=YYOVGEAEEZWWBC-UHFFFAOYSA-N
SMILES:C(N)C1=NC=2C(O1)=CC=CC2.Cl
Synonyms:
  • 2-Benzoxazolemethanamine, hydrochloride (1:1)
  • (Benzo[d]oxazol-2-yl)methanamine hydrochloride
  • (1,3-Benzoxazol-2-yl)methanamine hydrochloride
Found 5 products.