
CAS 1072812-57-7
:7-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzofuran
Description:
7-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzofuran is an organic compound characterized by its complex structure, which includes a benzofuran moiety and a dioxaborolane group. The presence of the benzofuran ring imparts aromatic properties, contributing to its stability and potential reactivity in various chemical reactions. The dioxaborolane group, which contains boron, is known for its ability to participate in cross-coupling reactions, making this compound potentially useful in synthetic organic chemistry, particularly in the formation of carbon-boron bonds. The methyl groups attached to both the benzofuran and the dioxaborolane enhance the lipophilicity of the compound, which may influence its solubility and interaction with biological systems. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, materials science, and catalysis, although specific reactivity and application details would depend on further experimental studies.
Formula:C15H19BO3
InChI:InChI=1S/C15H19BO3/c1-10-7-6-8-11-9-12(17-13(10)11)16-18-14(2,3)15(4,5)19-16/h6-9H,1-5H3
InChI key:InChIKey=OVINLUCADNOQQL-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2OC=3C(C2)=CC=CC3C
Synonyms:- Benzofuran, 7-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 7-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzofuran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.