CymitQuimica logo

CAS 1072813-63-8

:

2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethoxy)-1H-indole

Description:
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethoxy)-1H-indole is a chemical compound characterized by its unique structural features, which include an indole core substituted with a trifluoromethoxy group and a boron-containing moiety. The presence of the dioxaborolane group contributes to its potential reactivity and utility in various chemical reactions, particularly in organic synthesis and medicinal chemistry. The trifluoromethoxy group enhances the compound's lipophilicity and may influence its biological activity. This compound is likely to exhibit interesting properties such as fluorescence or specific binding interactions due to the indole structure, which is known for its role in many biological systems. Additionally, the presence of boron can facilitate coordination with other molecules, making it a candidate for applications in materials science and catalysis. Overall, this compound's unique combination of functional groups suggests potential utility in drug development and other advanced chemical applications.
Formula:C15H17BF3NO3
InChI:InChI=1S/C15H17BF3NO3/c1-13(2)14(3,4)23-16(22-13)11-8-9-6-5-7-10(12(9)20-11)21-15(17,18)19/h5-8,20H,1-4H3
InChI key:InChIKey=QYSPWVNGKNUUDF-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C2C(C=C(N2)B3OC(C)(C)C(C)(C)O3)=CC=C1
Synonyms:
  • 1H-Indole, 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethoxy)-
  • 2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-7-(trifluoromethoxy)-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.