CAS 1072833-77-2: Ixazomib
Description:Ixazomib is a small molecule proteasome inhibitor primarily used in the treatment of multiple myeloma. It functions by disrupting the proteasome's ability to degrade ubiquitinated proteins, leading to the accumulation of pro-apoptotic factors and ultimately inducing cancer cell death. Ixazomib is characterized by its oral bioavailability, making it a convenient option for patients compared to traditional intravenous therapies. The compound exhibits a specific mechanism of action that targets the 26S proteasome, which is crucial for regulating various cellular processes, including the cell cycle and apoptosis. Ixazomib is often used in combination with other therapies, such as lenalidomide and dexamethasone, to enhance its efficacy. Its pharmacokinetics involve metabolism primarily through the liver, with a half-life that supports once-weekly dosing. As with many cancer therapies, potential side effects may include thrombocytopenia, gastrointestinal disturbances, and peripheral neuropathy, necessitating careful monitoring during treatment. Overall, Ixazomib represents a significant advancement in the therapeutic landscape for multiple myeloma, providing an effective oral treatment option for patients.
Formula:C14H19BCl2N2O4
InChI:InChI=1S/C14H19BCl2N2O4/c1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/t12-/m0/s1
InChI key:InChIKey=MXAYKZJJDUDWDS-LBPRGKRZSA-N
SMILES:O=C(NCC(=O)NC(B(O)O)CC(C)C)C1=CC(Cl)=CC=C1Cl
- Synonyms:
- MLN 2238
- B-[(1R)-1-[[2-[(2,5-Dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]boronic acid
- Ninlaro
- Boronic acid, B-[(1R)-1-[[2-[(2,5-dichlorobenzoyl)amino]acetyl]amino]-3-methylbutyl]-
- Ixazomib