
CAS 107290-05-1
:(-)-6,7,7a,8-Tetrahydroquinazolino[3′,2′:1,6]pyrido[2,3-b][1,4]benzodiazepine-9,16-dione
Description:
The chemical substance known as (-)-6,7,7a,8-Tetrahydroquinazolino[3′,2′:1,6]pyrido[2,3-b][1,4]benzodiazepine-9,16-dione, with the CAS number 107290-05-1, is a complex organic compound characterized by its unique bicyclic structure that incorporates both benzodiazepine and quinazoline moieties. This compound typically exhibits a range of biological activities, which may include effects on the central nervous system, making it of interest in pharmacological research. Its stereochemistry is indicated by the prefix "(-)", suggesting it is the levorotatory form, which can influence its interaction with biological targets. The presence of multiple functional groups, including carbonyls and nitrogen atoms, contributes to its reactivity and potential for forming hydrogen bonds, which are crucial for its biological activity. Additionally, the compound's solubility and stability can vary based on environmental conditions, such as pH and temperature, which are important considerations for its application in medicinal chemistry. Overall, this substance represents a significant area of study for its potential therapeutic applications.
Formula:C19H14N4O2
InChI:InChI=1/C19H14N4O2/c24-18-11-5-1-3-7-13(11)21-17-15(22-18)9-10-16-20-14-8-4-2-6-12(14)19(25)23(16)17/h1-8,15H,9-10H2,(H,22,24)
InChI key:InChIKey=QSYOIPMDADNFRO-UHFFFAOYNA-N
SMILES:O=C1N2C=3C(CCC2=NC=4C1=CC=CC4)(NC(=O)C=5C(N3)=CC=CC5)[H]
Synonyms:- Quinazolino[3′,2′:1,6]pyrido[2,3-b][1,4]benzodiazepine-9,16-dione, 6,7,7a,8-tetrahydro-, (-)-
- Auranthine
- (-)-6,7,7a,8-Tetrahydroquinazolino[3′,2′:1,6]pyrido[2,3-b][1,4]benzodiazepine-9,16-dione
- Auranthin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Auranthine
CAS:Auranthine is a natural product that can be used as a reference standard. The CAS number of Auranthine is 107290-05-1.Formula:C19H14N4O2Color and Shape:SolidMolecular weight:330.347
