CAS 1072902-66-9
:N-[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzoyl]glycine
Description:
N-[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzoyl]glycine, commonly referred to as Fmoc-Gly-OBzl, is a chemical compound used primarily in peptide synthesis and biochemistry. It features a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is widely utilized to protect amino groups during the synthesis of peptides. The structure includes a glycine residue linked to a benzoyl group, enhancing its stability and solubility in organic solvents. This compound is typically a white to off-white solid and is soluble in common organic solvents like dimethyl sulfoxide (DMSO) and methanol, but less soluble in water. Its molecular structure allows for selective reactions, making it valuable in the synthesis of complex peptides. The Fmoc group can be easily removed under basic conditions, facilitating the subsequent coupling of amino acids. Overall, N-[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzoyl]glycine is an important reagent in the field of organic chemistry and peptide synthesis, contributing to advancements in drug development and biochemistry.
Formula:C24H20N2O5
InChI:InChI=1S/C24H20N2O5/c27-22(28)13-25-23(29)15-9-11-16(12-10-15)26-24(30)31-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21H,13-14H2,(H,25,29)(H,26,30)(H,27,28)
InChI key:InChIKey=KDFMTQUDCOODFY-UHFFFAOYSA-N
SMILES:C(OC(NC1=CC=C(C(NCC(O)=O)=O)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3
Synonyms:- 2-[[4-([[(9H-Fluoren-9-yl)methoxy]carbonyl]amino)phenyl]formamido]acetic acid
- Glycine, N-[4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]benzoyl]-
- 2-[(4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]phenyl)formamido]acetic acid
- N-[4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzoyl]glycine
- FMOC-4-AMINOHIPPURIC ACID
- (4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)benzoyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.