CAS 1072930-86-9
:1-[2-(3-Methoxyphenyl)ethenyl]-2-(phenylmethoxy)benzene
Description:
1-[2-(3-Methoxyphenyl)ethenyl]-2-(phenylmethoxy)benzene, identified by its CAS number 1072930-86-9, is an organic compound characterized by its complex structure, which includes multiple aromatic rings and methoxy groups. This compound features a vinyl group connecting two aromatic systems, contributing to its potential as a conjugated system, which may exhibit interesting electronic properties. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the compound's structural features suggest potential applications in fields such as organic electronics, photonics, or as a precursor in organic synthesis. Its unique arrangement of substituents may also impart specific optical properties, making it a candidate for studies in photophysical behavior. However, detailed studies on its physical and chemical properties, such as melting point, boiling point, and spectral characteristics, would be necessary to fully understand its behavior and potential applications in various scientific domains.
Formula:C22H20O2
InChI:InChI=1S/C22H20O2/c1-23-21-12-7-10-18(16-21)14-15-20-11-5-6-13-22(20)24-17-19-8-3-2-4-9-19/h2-16H,17H2,1H3/b15-14+
Synonyms:- 1-[2-(3-Methoxyphenyl)ethenyl]-2-(phenylmethoxy)-benzene
- 1-(Benzyloxy)-2-[(E)-2-(3-methoxyphenyl)vinyl]benzene
- 1-(Benzyloxy)-2-(3-methoxystyryl)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(Benzyloxy)-2-(3-methoxystyryl)benzene
CAS:Controlled Product<p>Applications 1-(Benzyloxy)-2-(3-methoxystyryl)benzene (CAS# 1072930-86-9) is a useful research chemical compound.<br></p>Formula:C22H20O2Color and Shape:NeatMolecular weight:316.393


