CymitQuimica logo

CAS 107294-90-6

:

4-Amino-N-[2-[[2-(sulfooxy)ethyl]sulfonyl]ethyl]benzamide

Description:
4-Amino-N-[2-[[2-(sulfooxy)ethyl]sulfonyl]ethyl]benzamide, with the CAS number 107294-90-6, is a chemical compound characterized by its complex structure that includes an amine group, a sulfonyl group, and a sulfooxy group. This compound is typically classified as an aromatic amide due to the presence of the benzamide moiety. The sulfonyl and sulfooxy groups contribute to its hydrophilicity, making it soluble in water and potentially useful in various biological applications. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with other molecules. This compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, particularly in drug design due to its functional groups that can interact with biological targets. Its specific applications and behavior in biological systems would depend on further studies, including its stability, reactivity, and interaction with other compounds.
Formula:C11H16N2O7S2
InChI:InChI=1S/C11H16N2O7S2/c12-10-3-1-9(2-4-10)11(14)13-5-7-21(15,16)8-6-20-22(17,18)19/h1-4H,5-8,12H2,(H,13,14)(H,17,18,19)
InChI key:InChIKey=ULQNNRMRJIVSDR-UHFFFAOYSA-N
SMILES:C(NCCS(CCOS(=O)(=O)O)(=O)=O)(=O)C1=CC=C(N)C=C1
Synonyms:
  • Benzamide, 4-amino-N-[2-[[2-(sulfooxy)ethyl]sulfonyl]ethyl]-
  • 4-Amino-N-[2-[[2-(sulfooxy)ethyl]sulfonyl]ethyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.