CAS 1072944-13-8
:B-(5-Chloro-2-fluoro-4-methyl-3-pyridinyl)boronic acid
Description:
B-(5-Chloro-2-fluoro-4-methyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound features a chlorine atom and a fluorine atom at specific positions on the pyridine ring, contributing to its unique reactivity and potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, including Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the presence of the methyl group enhances the lipophilicity of the molecule, potentially influencing its biological activity and solubility. The compound's structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Overall, B-(5-Chloro-2-fluoro-4-methyl-3-pyridinyl)boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C6H6BClFNO2
InChI:InChI=1S/C6H6BClFNO2/c1-3-4(8)2-10-6(9)5(3)7(11)12/h2,11-12H,1H3
InChI key:InChIKey=BGCCOWYOBWKPSC-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C)=C(Cl)C=NC1F
Synonyms:- Boronic acid, B-(5-chloro-2-fluoro-4-methyl-3-pyridinyl)-
- B-(5-Chloro-2-fluoro-4-methyl-3-pyridinyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5-Chloro-2-fluoro-4-methylpyridin-3-yl)boronic acid
CAS:Formula:C6H6BClFNO2Molecular weight:189.3797
