CAS 1072944-16-1: B-(3-Bromo-2-chloro-4-pyridinyl)boronic acid
Description:B-(3-Bromo-2-chloro-4-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that is substituted with both bromine and chlorine atoms. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of halogen substituents can influence its reactivity and solubility, potentially enhancing its biological activity or selectivity in chemical reactions. Additionally, the pyridine ring contributes to the compound's aromaticity and electronic properties, which can affect its interaction with biological targets. B-(3-Bromo-2-chloro-4-pyridinyl)boronic acid may also be utilized in the development of pharmaceuticals, particularly in the design of inhibitors for specific enzymes or receptors. Overall, its unique structural features make it a valuable compound in both research and industrial applications.
Formula:C5H4BBrClNO2
InChI:InChI=1S/C5H4BBrClNO2/c7-4-3(6(10)11)1-2-9-5(4)8/h1-2,10-11H
InChI key:InChIKey=FHSDUAXKXSMERY-UHFFFAOYSA-N
SMILES:ClC1=NC=CC(B(O)O)=C1Br
3-BROMO-2-CHLOROPYRIDINE-4-BORONIC ACID
Ref: IN-DA008R9X
| 1g | 99.00 € | ||
| 5g | 194.00 € | ||
| 100mg | 42.00 € | ||
| 250mg | 50.00 € |
3-Bromo-2-chloropyridine-4-boronic acid
Ref: 54-OR4323
| 1g | 78.00 € | ||
| 5g | 230.00 € | ||
| 25g | 574.00 € |
(3-Bromo-2-chloropyridin-4-yl)boronic acid
Ref: 10-F218993
| 1g | 80.00 € | ||
| 5g | 211.00 € | ||
| 10g | 327.00 € | ||
| 25g | 610.00 € |
3-Bromo-2-chloropyridine-4-boronic acid
Ref: 3D-FB159863
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
