CAS 1072944-21-8

B-[2-(Methylthio)-3-pyridinyl]boronic acid

Description:

B-[2-(Methylthio)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that has a methylthio substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The methylthio group enhances the compound's solubility and may influence its reactivity and interaction with biological targets. Additionally, the pyridine ring contributes to the compound's aromatic character, which can affect its electronic properties and stability. B-[2-(Methylthio)-3-pyridinyl]boronic acid may also exhibit potential as a ligand in coordination chemistry or as a building block in the synthesis of more complex molecules. Its specific applications and behavior in reactions can vary based on the conditions and the presence of other functional groups in a given chemical environment.

Formula: C₆H₈BNO₂S

InChI: InChI=1S/C6H8BNO2S/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4,9-10H,1H3

InChI key: InChIKey=QLZLLRKAZYHWTE-UHFFFAOYSA-N

SMILES: S(C)C1=C(B(O)O)C=CC=N1

Synonyms:

• Boronic acid, B-[2-(methylthio)-3-pyridinyl]-
• [2-(Methylsulfanyl)pyridin-3-yl]boronic acid
• B-[2-(Methylthio)-3-pyridinyl]boronic acid

(2-(Methylthio)pyridin-3-yl)boronic acid

CAS: 1072944-21-8

Formula: C₆H₈BNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 169.0092

Ref: IN-DA003BK7

2-(Methylthio)pyridine-3-boronic acid

CAS: 1072944-21-8

2-(Methylthio)pyridine-3-boronic acid

Purity: ≥95%

Molecular weight: 169.01g/mol

Ref: 54-OR361491

(2-(Methylthio)pyridin-3-yl)boronic acid

CAS: 1072944-21-8

Formula: C₆H₈BNO₂S

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 169.01

Ref: 10-F224700