CAS 1072944-33-2
:4-Bromo-3-methoxy-N-phenylbenzamide
Description:
4-Bromo-3-methoxy-N-phenylbenzamide is an organic compound characterized by its complex structure, which includes a bromine atom, a methoxy group, and a phenyl group attached to a benzamide backbone. This compound typically exhibits a crystalline solid form and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water due to its hydrophobic characteristics. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group can influence the compound's electronic properties and steric hindrance, affecting its biological activity and interactions. 4-Bromo-3-methoxy-N-phenylbenzamide may be of interest in medicinal chemistry and pharmaceutical research, particularly for its potential applications in drug development. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C14H12BrNO2
InChI:InChI=1S/C14H12BrNO2/c1-18-13-9-10(7-8-12(13)15)14(17)16-11-5-3-2-4-6-11/h2-9H,1H3,(H,16,17)
InChI key:InChIKey=AIWJLYCHRYWNNL-UHFFFAOYSA-N
SMILES:C(NC1=CC=CC=C1)(=O)C2=CC(OC)=C(Br)C=C2
Synonyms:- Benzamide, 4-bromo-3-methoxy-N-phenyl-
- 4-Bromo-3-methoxy-N-phenylbenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
