CAS 1072944-35-4
:4-Bromo-N-cyclopropyl-3-methoxybenzamide
Description:
4-Bromo-N-cyclopropyl-3-methoxybenzamide is a chemical compound characterized by its unique structural features, which include a bromine atom, a cyclopropyl group, and a methoxy substituent on a benzamide framework. The presence of the bromine atom introduces notable reactivity and can influence the compound's biological activity, while the cyclopropyl group contributes to its three-dimensional shape, potentially affecting its interaction with biological targets. The methoxy group enhances solubility and can also participate in hydrogen bonding, influencing the compound's overall polarity. This compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental conditions such as temperature and pH. Proper handling and safety measures are essential when working with this compound, as with any chemical substance.
Formula:C11H12BrNO2
InChI:InChI=1S/C11H12BrNO2/c1-15-10-6-7(2-5-9(10)12)11(14)13-8-3-4-8/h2,5-6,8H,3-4H2,1H3,(H,13,14)
InChI key:InChIKey=ACZUAJCGIAVKNK-UHFFFAOYSA-N
SMILES:C(NC1CC1)(=O)C2=CC(OC)=C(Br)C=C2
Synonyms:- Benzamide, 4-bromo-N-cyclopropyl-3-methoxy-
- 4-Bromo-N-cyclopropyl-3-methoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
