CAS 1072944-36-5
:4-Bromo-N-(2-furanylmethyl)-3-methoxybenzamide
Description:
4-Bromo-N-(2-furanylmethyl)-3-methoxybenzamide is an organic compound characterized by its unique structural features, which include a bromine atom, a methoxy group, and a furan moiety. The presence of the bromine atom introduces notable electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. The furan ring contributes to the compound's aromatic character and can participate in further chemical transformations. This compound may exhibit interesting pharmacological properties, as many derivatives of benzamides are known for their biological activities, including anti-inflammatory and anticancer effects. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and reactivity under different conditions. Overall, 4-Bromo-N-(2-furanylmethyl)-3-methoxybenzamide represents a complex structure with potential utility in medicinal chemistry and organic synthesis.
Formula:C13H12BrNO3
InChI:InChI=1S/C13H12BrNO3/c1-17-12-7-9(4-5-11(12)14)13(16)15-8-10-3-2-6-18-10/h2-7H,8H2,1H3,(H,15,16)
InChI key:InChIKey=YVMYXOXEBXTIEM-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CO1)(=O)C2=CC(OC)=C(Br)C=C2
Synonyms:- 4-Bromo-N-(2-furanylmethyl)-3-methoxybenzamide
- Benzamide, 4-bromo-N-(2-furanylmethyl)-3-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
