CymitQuimica logo

CAS 1072944-40-1

:

4-Bromo-N-cyclohexyl-3-methoxybenzamide

Description:
4-Bromo-N-cyclohexyl-3-methoxybenzamide is an organic compound characterized by its structural features, which include a bromine atom, a cyclohexyl group, and a methoxybenzamide moiety. This compound belongs to the class of amides, which are characterized by the presence of a carbonyl group (C=O) linked to a nitrogen atom (N). The bromine substituent on the benzene ring can influence the compound's reactivity and physical properties, such as solubility and boiling point. The methoxy group (-OCH3) enhances the electron-donating characteristics of the aromatic system, potentially affecting its interaction with biological targets. The cyclohexyl group contributes to the compound's hydrophobic character, which may influence its pharmacokinetics and bioavailability in biological systems. Overall, the combination of these functional groups suggests that 4-Bromo-N-cyclohexyl-3-methoxybenzamide may exhibit interesting chemical behavior and potential applications in medicinal chemistry or material science, although specific biological activity would require further investigation.
Formula:C14H18BrNO2
InChI:InChI=1S/C14H18BrNO2/c1-18-13-9-10(7-8-12(13)15)14(17)16-11-5-3-2-4-6-11/h7-9,11H,2-6H2,1H3,(H,16,17)
InChI key:InChIKey=YGGBJKQZGYGQQO-UHFFFAOYSA-N
SMILES:C(NC1CCCCC1)(=O)C2=CC(OC)=C(Br)C=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.