CAS 1072944-46-7
:Methyl 4-(1,1-dimethylethyl)-2-methyl-5-thiazolecarboxylate
Description:
Methyl 4-(1,1-dimethylethyl)-2-methyl-5-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which contributes to its unique chemical properties. This compound features a methyl ester functional group, indicating it can participate in esterification and hydrolysis reactions. The presence of the bulky tert-butyl group (1,1-dimethylethyl) enhances its steric hindrance, potentially influencing its reactivity and solubility in various solvents. The thiazole moiety is known for its biological activity, often being a part of compounds with antimicrobial or antifungal properties. Additionally, the methyl groups attached to the thiazole ring can affect the compound's electronic properties and stability. This substance is typically used in synthetic organic chemistry and may serve as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H15NO2S
InChI:InChI=1S/C10H15NO2S/c1-6-11-8(10(2,3)4)7(14-6)9(12)13-5/h1-5H3
InChI key:InChIKey=RUEUMJDNWGEPSR-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=C(C(OC)=O)SC(C)=N1
Synonyms:- Methyl 4-(1,1-dimethylethyl)-2-methyl-5-thiazolecarboxylate
- 5-Thiazolecarboxylic acid, 4-(1,1-dimethylethyl)-2-methyl-, methyl ester
- METHYL 4-TERT-BUTYL-2-METHYLTHIAZOLE-5-CARBOXYLATE
- 4-(1,1-Dimethylethyl)-2-methyl-5-thiazolecarboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
