CymitQuimica logo

CAS 1072944-47-8

:

Methyl 5-cyclopropyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylate

Description:
Methyl 5-cyclopropyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its unique structural features, which include a pyrazole ring, a cyclopropyl group, and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the carboxylate functional group suggests it may participate in various chemical reactions, including esterification and nucleophilic substitutions. Its molecular structure allows for interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the compound's specific stereochemistry and substituents can influence its reactivity and pharmacological profile. As with many pyrazole derivatives, it may exhibit anti-inflammatory, analgesic, or other therapeutic effects, although detailed biological activity would require empirical investigation. Overall, Methyl 5-cyclopropyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylate represents a class of compounds that are valuable in both synthetic chemistry and pharmaceutical research.
Formula:C13H13N3O2
InChI:InChI=1S/C13H13N3O2/c1-18-13(17)10-8-15-16(12(10)9-5-6-9)11-4-2-3-7-14-11/h2-4,7-9H,5-6H2,1H3
InChI key:InChIKey=KJDDTEUYLRYFRF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N(N=C1)C2=CC=CC=N2)C3CC3
Synonyms:
  • Methyl 5-cyclopropyl-1-(2-pyridinyl)-1H-pyrazole-4-carboxylate
  • 1H-Pyrazole-4-carboxylic acid, 5-cyclopropyl-1-(2-pyridinyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.