CAS 1072944-49-0
:Piperidine, 4-(2-nitrophenoxy)-, hydrochloride (1:1)
Description:
Piperidine, 4-(2-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a nitrophenoxy group at the 4-position of the piperidine ring, contributing to its unique chemical properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the nitro group may impart specific reactivity and influence the compound's interaction with biological targets. This compound is often studied for its potential effects in medicinal chemistry, particularly in the development of new therapeutic agents. Safety data and handling precautions should be observed, as with any chemical substance, due to potential toxicity associated with nitro compounds. Overall, Piperidine, 4-(2-nitrophenoxy)-, hydrochloride is a notable compound in the field of organic chemistry and pharmacology.
Formula:C11H14N2O3·ClH
InChI:InChI=1S/C11H14N2O3.ClH/c14-13(15)10-3-1-2-4-11(10)16-9-5-7-12-8-6-9;/h1-4,9,12H,5-8H2;1H
InChI key:InChIKey=JGIKYGXQGXORFY-UHFFFAOYSA-N
SMILES:O(C1=C(N(=O)=O)C=CC=C1)C2CCNCC2.Cl
Synonyms:- Piperidine, 4-(2-nitrophenoxy)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
