CAS 1072944-54-7: Methyl 4-cyclopropyl-2-(4-morpholinyl)-5-pyrimidinecarboxylate
Description:Methyl 4-cyclopropyl-2-(4-morpholinyl)-5-pyrimidinecarboxylate, identified by its CAS number 1072944-54-7, is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a cyclopropyl group introduces strain and unique reactivity patterns, while the morpholine moiety contributes to its potential biological activity and solubility properties. This compound is typically classified as a pyrimidine derivative and may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The methyl ester functional group enhances its lipophilicity, potentially influencing its absorption and distribution in biological systems. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental conditions such as pH and temperature. Further studies would be necessary to elucidate its specific properties and potential applications in drug development or other fields.
Formula:C13H17N3O3
InChI:InChI=1S/C13H17N3O3/c1-18-12(17)10-8-14-13(15-11(10)9-2-3-9)16-4-6-19-7-5-16/h8-9H,2-7H2,1H3
InChI key:InChIKey=OQSZLDIEOJGDBU-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CN=C(N=C1C2CC2)N3CCOCC3
- Synonyms:
- 5-Pyrimidinecarboxylic acid, 4-cyclopropyl-2-(4-morpholinyl)-, methyl ester
- Methyl 4-cyclopropyl-2-(4-morpholinyl)-5-pyrimidinecarboxylate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate REF: IN-DA003RV5CAS: 1072944-54-7 | - - - | To inquire | Fri 21 Mar 25 |
 | Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate REF: 10-F236390CAS: 1072944-54-7 | 95.0% | - - - | Discontinued product |
 | Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate REF: 3D-XSB94454CAS: 1072944-54-7 | Min. 95% | - - - | Discontinued product |
Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate
Ref: IN-DA003RV5
| Undefined size | To inquire |
Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate
Ref: 10-F236390
| 1g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
Methyl 4-cyclopropyl-2-morpholinopyrimidine-5-carboxylate
Ref: 3D-XSB94454
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
