CAS 1072944-62-7
:4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran
Description:
4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran is an organic compound characterized by its complex structure, which includes a tetrahydropyran ring and a phenoxy group substituted with a bromine and a nitro group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. The nitro group, known for its electron-withdrawing properties, can influence the compound's reactivity and stability, affecting its interactions in chemical reactions. This compound is likely to exhibit moderate to high polarity due to the presence of the nitro and bromine substituents, which can also impact its solubility in different solvents. Additionally, the tetrahydropyran moiety contributes to the compound's cyclic structure, which may affect its conformation and steric hindrance. Overall, 4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran is a versatile compound that may find applications in organic synthesis, medicinal chemistry, or as an intermediate in the production of more complex molecules.
Formula:C11H12BrNO4
InChI:InChI=1S/C11H12BrNO4/c12-10-7-8(13(14)15)1-2-11(10)17-9-3-5-16-6-4-9/h1-2,7,9H,3-6H2
InChI key:InChIKey=YSKAVPMKTKFJEA-UHFFFAOYSA-N
SMILES:O(C1=C(Br)C=C(N(=O)=O)C=C1)C2CCOCC2
Synonyms:- 2H-Pyran, 4-(2-bromo-4-nitrophenoxy)tetrahydro-
- 4-(2-Bromo-4-nitrophenoxy)tetrahydro-2H-pyran
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
