CAS 1072944-65-0
:3,6-Dibromo-7-methylimidazo[1,2-a]pyridine
Description:
3,6-Dibromo-7-methylimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its aromatic properties. The presence of bromine substituents at the 3 and 6 positions, along with a methyl group at the 7 position, influences its reactivity and potential biological activity. This compound is of interest in the field of medicinal chemistry and toxicology, particularly due to its structural similarity to certain carcinogenic compounds. Its molecular structure may affect its solubility, stability, and interaction with biological systems. Additionally, the bromine atoms can enhance the compound's lipophilicity, potentially influencing its absorption and distribution in biological organisms. As a synthetic intermediate, it may be utilized in the development of pharmaceuticals or as a research tool in studying the mechanisms of action of related compounds. Safety and handling precautions are essential due to the potential toxicity associated with brominated compounds.
Formula:C8H6Br2N2
InChI:InChI=1S/C8H6Br2N2/c1-5-2-8-11-3-7(10)12(8)4-6(5)9/h2-4H,1H3
InChI key:InChIKey=FTWJABDZQQPATE-UHFFFAOYSA-N
SMILES:BrC=1N2C(C=C(C)C(Br)=C2)=NC1
Synonyms:- 3,6-Dibromo-7-methylimidazo[1,2-a]pyridine
- Imidazo[1,2-a]pyridine, 3,6-dibromo-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
