CymitQuimica logo

CAS 1072944-67-2

:

4-bromo-7-chloro-8-methyl-2-(trifluoromethyl)quinoline

Description:
4-Bromo-7-chloro-8-methyl-2-(trifluoromethyl)quinoline is a synthetic organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features several notable substituents: a bromine atom at the 4-position, a chlorine atom at the 7-position, a methyl group at the 8-position, and a trifluoromethyl group at the 2-position. These substituents contribute to its unique chemical properties, including potential biological activity and reactivity. The presence of halogens (bromine, chlorine, and trifluoromethyl) often enhances lipophilicity and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the methyl group can affect the compound's steric properties and overall stability. The compound's molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, although specific applications would depend on further research into its biological activity and chemical behavior. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.
Formula:C11H6BrClF3N
InChI:InChI=1S/C11H6BrClF3N/c1-5-8(13)3-2-6-7(12)4-9(11(14,15)16)17-10(5)6/h2-4H,1H3
InChI key:InChIKey=WOJBMSDNICSYGL-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(Br)=CC(C(F)(F)F)=N2)C=CC1Cl
Synonyms:
  • 4-Bromo-7-chloro-8-methyl-2-trifluoromethylquinoline
  • Quinoline, 4-bromo-7-chloro-8-methyl-2-(trifluoromethyl)-
  • 4-Bromo-7-chloro-8-methyl-2-(trifluoromethyl)quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.