CAS 1072944-70-7
:3-(2-Bromophenyl)-5-ethyl-1,2,4-oxadiazole
Description:
3-(2-Bromophenyl)-5-ethyl-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. The compound features a bromophenyl group at the 3-position and an ethyl group at the 5-position of the oxadiazole ring, contributing to its unique chemical properties. This structure imparts specific reactivity and potential applications in fields such as pharmaceuticals, agrochemicals, and materials science. The presence of the bromine atom enhances the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the ethyl group can influence the compound's solubility and stability. The compound's molecular interactions and potential biological activities are subjects of interest in medicinal chemistry, where derivatives of oxadiazole are often explored for their antimicrobial, anti-inflammatory, and anticancer properties. Overall, 3-(2-Bromophenyl)-5-ethyl-1,2,4-oxadiazole represents a versatile scaffold for further chemical exploration and development.
Formula:C10H9BrN2O
InChI:InChI=1S/C10H9BrN2O/c1-2-9-12-10(13-14-9)7-5-3-4-6-8(7)11/h3-6H,2H2,1H3
InChI key:InChIKey=NBXMWJPFQWSYPR-UHFFFAOYSA-N
SMILES:BrC1=C(C=2N=C(CC)ON2)C=CC=C1
Synonyms:- 1,2,4-Oxadiazole, 3-(2-bromophenyl)-5-ethyl-
- 3-(2-Bromophenyl)-5-ethyl-1,2,4-oxadiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
