CAS 1072944-73-0
:5-(2-Chloro-1,1-dimethylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole
Description:
5-(2-Chloro-1,1-dimethylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a chloro substituent on the isopropyl group enhances its reactivity and potential applications in various chemical reactions. The para-methylphenyl group contributes to the compound's hydrophobic characteristics and may influence its solubility and interaction with biological systems. This compound is typically studied for its potential applications in pharmaceuticals, agrochemicals, or materials science due to its unique structural features. Its molecular structure suggests potential for diverse interactions, making it a candidate for further research in medicinal chemistry or as a building block in organic synthesis. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C13H15ClN2O
InChI:InChI=1S/C13H15ClN2O/c1-9-4-6-10(7-5-9)11-15-12(17-16-11)13(2,3)8-14/h4-7H,8H2,1-3H3
InChI key:InChIKey=WAZNIYBWXVNEDJ-UHFFFAOYSA-N
SMILES:C(CCl)(C)(C)C1=NC(=NO1)C2=CC=C(C)C=C2
Synonyms:- 5-(2-Chloro-1,1-dimethylethyl)-3-(4-methylphenyl)-1,2,4-oxadiazole
- 1,2,4-Oxadiazole, 5-(2-chloro-1,1-dimethylethyl)-3-(4-methylphenyl)-
- 5-(1-CHLORO-2-METHYLPROPAN-2-YL)-3-P-TOLYL-1,2,4-OXADIAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(1-Chloro-2-methylpropan-2-yl)-3-p-tolyl-1,2,4-oxadiazole
CAS:Formula:C13H15ClN2OMolecular weight:250.7240
