CAS 1072944-74-1
:7-Chloro-8-methyl-4-(1-piperidinyl)quinoline
Description:
7-Chloro-8-methyl-4-(1-piperidinyl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 7-position and a methyl group at the 8-position contributes to its unique reactivity and potential biological activity. The 4-position features a piperidinyl substituent, which may enhance its interaction with biological targets, making it of interest in medicinal chemistry. This compound is typically studied for its potential pharmacological properties, including antimicrobial or antitumor activities. Its molecular structure suggests it may exhibit lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the presence of nitrogen atoms in both the quinoline and piperidine rings may contribute to its ability to form hydrogen bonds, impacting its binding affinity to various receptors or enzymes. Overall, 7-Chloro-8-methyl-4-(1-piperidinyl)quinoline represents a class of compounds that could be valuable in drug development and therapeutic applications.
Formula:C15H17ClN2
InChI:InChI=1S/C15H17ClN2/c1-11-13(16)6-5-12-14(7-8-17-15(11)12)18-9-3-2-4-10-18/h5-8H,2-4,9-10H2,1H3
InChI key:InChIKey=ITPJKYOGOLBIFN-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(=CC=N2)N3CCCCC3)C=CC1Cl
Synonyms:- Quinoline, 7-chloro-8-methyl-4-(1-piperidinyl)-
- 7-Chloro-8-methyl-4-(1-piperidinyl)quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
