CAS 1072944-76-3
:Methyl 4-cyclopropyl-2-(methylthio)-5-pyrimidinecarboxylate
Description:
Methyl 4-cyclopropyl-2-(methylthio)-5-pyrimidinecarboxylate is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing nitrogen atoms. The presence of a cyclopropyl group introduces unique steric and electronic properties, potentially influencing the compound's reactivity and biological activity. The methylthio group contributes to its sulfur content, which can enhance lipophilicity and affect solubility in organic solvents. As an ester, it features a carboxylate functional group, which can participate in various chemical reactions, including hydrolysis and transesterification. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further studies and characterization, including its interaction with biological targets and its stability under various conditions. Overall, the structural features of this compound suggest potential utility in drug development and other chemical applications.
Formula:C10H12N2O2S
InChI:InChI=1S/C10H12N2O2S/c1-14-9(13)7-5-11-10(15-2)12-8(7)6-3-4-6/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=AHCQLIHOJARIKX-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(=NC(SC)=NC1)C2CC2
Synonyms:- 5-Pyrimidinecarboxylic acid, 4-cyclopropyl-2-(methylthio)-, methyl ester
- Methyl 4-cyclopropyl-2-(methylthio)-5-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 4-cyclopropyl-2-(methylthio)pyrimidine-5-carboxylate
CAS:Formula:C10H12N2O2SMolecular weight:224.2795
