CymitQuimica logo

CAS 1072944-77-4

:

Methyl 8-bromo-4-hydroxy-5-(trifluoromethyl)-2-quinolinecarboxylate

Description:
Methyl 8-bromo-4-hydroxy-5-(trifluoromethyl)-2-quinolinecarboxylate is a chemical compound characterized by its complex structure, which includes a quinoline core, a bromine substituent, and a trifluoromethyl group. The presence of the bromine atom at the 8-position and the hydroxy group at the 4-position contribute to its reactivity and potential biological activity. The trifluoromethyl group enhances lipophilicity and can influence the compound's pharmacokinetic properties. This compound is likely to exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to the quinoline moiety, which is known for its diverse biological activities, including antimicrobial and antimalarial effects. Additionally, the methyl ester functional group may play a role in its solubility and reactivity in various chemical reactions. Overall, Methyl 8-bromo-4-hydroxy-5-(trifluoromethyl)-2-quinolinecarboxylate represents a unique structure that could be of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H7BrF3NO3
InChI:InChI=1S/C12H7BrF3NO3/c1-20-11(19)7-4-8(18)9-5(12(14,15)16)2-3-6(13)10(9)17-7/h2-4H,1H3,(H,17,18)
InChI key:InChIKey=OPEUYXHXFXICBM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C2=C(N=C(C(OC)=O)C=C2O)C(Br)=CC1
Synonyms:
  • Methyl 8-bromo-4-hydroxy-5-(trifluoromethyl)-2-quinolinecarboxylate
  • 2-Quinolinecarboxylic acid, 8-bromo-4-hydroxy-5-(trifluoromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.