CAS 1072944-87-6
:Methyl 4-(4-chlorophenyl)-5-isoxazolecarboxylate
Description:
Methyl 4-(4-chlorophenyl)-5-isoxazolecarboxylate is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a 4-chlorophenyl group indicates that it has a chlorine substituent on the phenyl ring, which can influence its biological activity and chemical behavior. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The isoxazole moiety is often associated with various biological activities, including anti-inflammatory and analgesic effects. Additionally, the compound's molecular structure suggests potential applications in agrochemicals or as intermediates in organic synthesis. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, Methyl 4-(4-chlorophenyl)-5-isoxazolecarboxylate represents a versatile compound with potential applications in various fields of chemistry.
Formula:C11H8ClNO3
InChI:InChI=1S/C11H8ClNO3/c1-15-11(14)10-9(6-13-16-10)7-2-4-8(12)5-3-7/h2-6H,1H3
InChI key:InChIKey=QCVYAVASMNNCGK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=NO1)C2=CC=C(Cl)C=C2
Synonyms:- Methyl 4-(4-chlorophenyl)-5-isoxazolecarboxylate
- 5-Isoxazolecarboxylic acid, 4-(4-chlorophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
