CymitQuimica logo

CAS 1072944-91-2

:

2,4-dibenzyloxy-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrimidine

Description:
2,4-Dibenzyloxy-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrimidine is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrimidine ring substituted with two benzyloxy groups and a dioxaborinane moiety. The presence of the dioxaborinane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions and as a building block for more complex molecules. The compound's structure indicates it may exhibit interesting electronic properties due to the conjugation between the pyrimidine and the benzyloxy substituents. Additionally, the bulky dimethyl groups in the dioxaborinane may influence its steric properties, potentially affecting its reactivity and solubility in various solvents. The compound's unique features may make it valuable in medicinal chemistry or materials science, although specific biological activities or applications would require further investigation. Overall, 2,4-dibenzyloxy-5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)pyrimidine represents a noteworthy example of modern synthetic chemistry with potential utility in various fields.
Formula:C23H25BN2O4
InChI:InChI=1/C23H25BN2O4/c1-23(2)16-29-24(30-17-23)20-13-25-22(28-15-19-11-7-4-8-12-19)26-21(20)27-14-18-9-5-3-6-10-18/h3-13H,14-17H2,1-2H3
SMILES:CC1(C)COB(c2cnc(nc2OCc2ccccc2)OCc2ccccc2)OC1
Synonyms:
  • T6Obotj E1 E1 B- Et6N Cnj Bo1R& Do1R
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.