CymitQuimica logo

CAS 1072944-94-5

:

1-Bromo-3-ethoxy-2-iodobenzene

Description:
1-Bromo-3-ethoxy-2-iodobenzene is an organic compound characterized by the presence of both bromine and iodine substituents on a benzene ring, along with an ethoxy group. Its molecular structure features a benzene ring with a bromine atom at the first position, an ethoxy group (-OCH2CH3) at the third position, and an iodine atom at the second position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents due to the presence of the ethoxy group, while its reactivity can be influenced by the halogen substituents, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of both bromine and iodine can also impart unique properties, such as increased reactivity and potential applications in medicinal chemistry or materials science. Safety precautions should be taken when handling this compound, as halogenated compounds can be hazardous.
Formula:C8H8BrIO
InChI:InChI=1S/C8H8BrIO/c1-2-11-7-5-3-4-6(9)8(7)10/h3-5H,2H2,1H3
InChI key:InChIKey=VFVWGSAUFKCRRF-UHFFFAOYSA-N
SMILES:O(CC)C1=C(I)C(Br)=CC=C1
Synonyms:
  • 1-Bromo-3-ethoxy-2-iodobenzene
  • Benzene, 1-bromo-3-ethoxy-2-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.