CAS 1072944-95-6
:3-Bromo-N-pentylbenzenesulfonamide
Description:
3-Bromo-N-pentylbenzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is attached to a benzene ring that also bears a bromine atom at the meta position and a pentyl group at the nitrogen. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the long alkyl chain. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in organic synthesis or medicinal chemistry. The sulfonamide group is known for its biological activity, often serving as a pharmacophore in drug design. Additionally, the compound may exhibit properties such as antimicrobial activity, making it of interest in pharmaceutical research. Its molecular structure contributes to its physical and chemical properties, including melting point, boiling point, and reactivity with various reagents. As with many sulfonamides, it may also participate in hydrogen bonding due to the nitrogen atom, affecting its solubility and interaction with biological targets.
Formula:C11H16BrNO2S
InChI:InChI=1S/C11H16BrNO2S/c1-2-3-4-8-13-16(14,15)11-7-5-6-10(12)9-11/h5-7,9,13H,2-4,8H2,1H3
InChI key:InChIKey=JNKMWBVQCVFSJI-UHFFFAOYSA-N
SMILES:S(NCCCCC)(=O)(=O)C1=CC(Br)=CC=C1
Synonyms:- Benzenesulfonamide, 3-bromo-N-pentyl-
- 3-Bromo-N-pentylbenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
