CAS 1072945-01-7
:2-ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its pyridine ring, which is substituted at the 5-position with a boron-containing moiety. The presence of the ethoxy group at the 2-position enhances its solubility in organic solvents and may influence its reactivity. The tetramethyl-1,3,2-dioxaborolane group contributes to its potential as a boron source in various chemical reactions, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the boron atom, which can participate in coordination and nucleophilic reactions. Additionally, the compound's structure suggests it may have applications in medicinal chemistry or materials science, particularly in the development of boron-containing ligands or catalysts. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.
Formula:C13H20BNO3
InChI:InChI=1/C13H20BNO3/c1-6-16-11-8-7-10(9-15-11)14-17-12(2,3)13(4,5)18-14/h7-9H,6H2,1-5H3
SMILES:CCOc1ccc(cn1)B1OC(C)(C)C(C)(C)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Ethoxypyridine-5-boronic acid pinacol ester, 99%
CAS:<p>2-Ethoxypyridine-5-boronic acid pinacol ester is used as raw material for synthesis of pharmaceutical intermediates. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The ori</p>Formula:C13H20BNO3Purity:99%Molecular weight:249.122-Ethoxypyridine-5-boronic acid, pinacol ester
CAS:Formula:C13H20BNO3Purity:98%Color and Shape:SolidMolecular weight:249.11382-Ethoxypyridine-5-boronic acid, pinacol ester
CAS:<p>2-Ethoxypyridine-5-boronic acid, pinacol ester</p>Purity:98%Molecular weight:249.11g/mol2-Ethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C13H20BNO3Purity:98%Color and Shape:LiquidMolecular weight:249.12



